Benzene and substituted derivatives
Filtered Search Results
2-Fluorotoluene, 99+%
CAS: 95-52-3 Molecular Formula: C7H7F Molecular Weight (g/mol): 110.131 MDL Number: MFCD00000322 InChI Key: MMZYCBHLNZVROM-UHFFFAOYSA-N Synonym: 2-fluorotoluene,o-fluorotoluene,benzene, 1-fluoro-2-methyl,toluene, o-fluoro,1-methyl-2-fluorobenzene,unii-l55xkb3k7h,1-fluoro-2-methyl-benzene,ortho-fluorotoluene,fluorotoluene,l55xkb3k7h PubChem CID: 7241 IUPAC Name: 1-fluoro-2-methylbenzene SMILES: CC1=CC=CC=C1F
| PubChem CID | 7241 |
|---|---|
| CAS | 95-52-3 |
| Molecular Weight (g/mol) | 110.131 |
| MDL Number | MFCD00000322 |
| SMILES | CC1=CC=CC=C1F |
| Synonym | 2-fluorotoluene,o-fluorotoluene,benzene, 1-fluoro-2-methyl,toluene, o-fluoro,1-methyl-2-fluorobenzene,unii-l55xkb3k7h,1-fluoro-2-methyl-benzene,ortho-fluorotoluene,fluorotoluene,l55xkb3k7h |
| IUPAC Name | 1-fluoro-2-methylbenzene |
| InChI Key | MMZYCBHLNZVROM-UHFFFAOYSA-N |
| Molecular Formula | C7H7F |
o-Xylylene dibromide, 97%
CAS: 91-13-4 Molecular Formula: C8H8Br2 Molecular Weight (g/mol): 263.96 MDL Number: MFCD00000175 InChI Key: KGKAYWMGPDWLQZ-UHFFFAOYSA-N Synonym: 1,2-bis bromomethyl benzene,o-xylylene dibromide,alpha,alpha'-dibromo-o-xylene,benzene, 1,2-bis bromomethyl,o-bis bromomethyl benzene,o-xylylene bromide,1,2-dibenzyl bromide,alpha,alpha'-dibromo-o-xylol,a,a'-dibromo-o-xylene,ccris 1776 PubChem CID: 66665 IUPAC Name: 1,2-bis(bromomethyl)benzene SMILES: C1=CC=C(C(=C1)CBr)CBr
| PubChem CID | 66665 |
|---|---|
| CAS | 91-13-4 |
| Molecular Weight (g/mol) | 263.96 |
| MDL Number | MFCD00000175 |
| SMILES | C1=CC=C(C(=C1)CBr)CBr |
| Synonym | 1,2-bis bromomethyl benzene,o-xylylene dibromide,alpha,alpha'-dibromo-o-xylene,benzene, 1,2-bis bromomethyl,o-bis bromomethyl benzene,o-xylylene bromide,1,2-dibenzyl bromide,alpha,alpha'-dibromo-o-xylol,a,a'-dibromo-o-xylene,ccris 1776 |
| IUPAC Name | 1,2-bis(bromomethyl)benzene |
| InChI Key | KGKAYWMGPDWLQZ-UHFFFAOYSA-N |
| Molecular Formula | C8H8Br2 |
3-Chlorobenzyl bromide, 97%
CAS: 766-80-3 Molecular Formula: C7H6BrCl Molecular Weight (g/mol): 205.48 MDL Number: MFCD00000597 InChI Key: LZIYAIRGDHSVED-UHFFFAOYSA-N Synonym: 3-chlorobenzyl bromide,1-bromomethyl-3-chlorobenzene,3-chlorobenzylbromide,alpha-bromo-3-chlorotoluene,m-chlorobenzyl bromide,benzene, 1-bromomethyl-3-chloro,alpha-bromo-m-chlorotoluene,.alpha.-bromo-m-chlorotoluene,1-bromomethyl-3-chloro-benzene,3-chorobenzylbromide PubChem CID: 69838 IUPAC Name: 1-(bromomethyl)-3-chlorobenzene SMILES: ClC1=CC=CC(CBr)=C1
| PubChem CID | 69838 |
|---|---|
| CAS | 766-80-3 |
| Molecular Weight (g/mol) | 205.48 |
| MDL Number | MFCD00000597 |
| SMILES | ClC1=CC=CC(CBr)=C1 |
| Synonym | 3-chlorobenzyl bromide,1-bromomethyl-3-chlorobenzene,3-chlorobenzylbromide,alpha-bromo-3-chlorotoluene,m-chlorobenzyl bromide,benzene, 1-bromomethyl-3-chloro,alpha-bromo-m-chlorotoluene,.alpha.-bromo-m-chlorotoluene,1-bromomethyl-3-chloro-benzene,3-chorobenzylbromide |
| IUPAC Name | 1-(bromomethyl)-3-chlorobenzene |
| InChI Key | LZIYAIRGDHSVED-UHFFFAOYSA-N |
| Molecular Formula | C7H6BrCl |
Ribonucleic acid, MP Biomedicals™
CAS: 63231-63-0 MDL Number: MFCD00132196 Synonym: RNA IUPAC Name: Ribonucleic acid
| CAS | 63231-63-0 |
|---|---|
| MDL Number | MFCD00132196 |
| Synonym | RNA |
| IUPAC Name | Ribonucleic acid |
2-Iodosobenzoic acid, 97%
CAS: 304-91-6 Molecular Formula: C7H5IO3 Molecular Weight (g/mol): 264.018 MDL Number: MFCD00002401 InChI Key: IFPHDUVGLXEIOQ-UHFFFAOYSA-N Synonym: 2-iodosobenzoic acid,o-iodosobenzoic acid,o-iodosylbenzoic acid,o-iodosobenzoate,benzoic acid, 2-iodosyl,benzoic acid, o-iodoso,2-iodosyl benzoate,benzoic acid, iodosyl,ortho-iodosylbenzoic acid,3h-1,2-benziodoxol-1-ium, 3-oxo-, hydroxide PubChem CID: 67537 ChEBI: CHEBI:52698 IUPAC Name: 2-iodosylbenzoic acid SMILES: C1=CC=C(C(=C1)C(=O)O)I=O
| PubChem CID | 67537 |
|---|---|
| CAS | 304-91-6 |
| Molecular Weight (g/mol) | 264.018 |
| ChEBI | CHEBI:52698 |
| MDL Number | MFCD00002401 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)I=O |
| Synonym | 2-iodosobenzoic acid,o-iodosobenzoic acid,o-iodosylbenzoic acid,o-iodosobenzoate,benzoic acid, 2-iodosyl,benzoic acid, o-iodoso,2-iodosyl benzoate,benzoic acid, iodosyl,ortho-iodosylbenzoic acid,3h-1,2-benziodoxol-1-ium, 3-oxo-, hydroxide |
| IUPAC Name | 2-iodosylbenzoic acid |
| InChI Key | IFPHDUVGLXEIOQ-UHFFFAOYSA-N |
| Molecular Formula | C7H5IO3 |
4-Iodophenyl isocyanate, 97%
CAS: 15845-62-2 Molecular Formula: C7H4INO Molecular Weight (g/mol): 245.019 MDL Number: MFCD00013875 InChI Key: KVMKUTIUJGYHBA-UHFFFAOYSA-N Synonym: 4-iodophenyl isocyanate,4-iodophenylisocyanate,1-iodo-4-isocyanato-benzene,p-iodophenylisocyanate,acmc-1bsbj,benzene,1-iodo-4-isocyanato PubChem CID: 3399787 IUPAC Name: 1-iodo-4-isocyanatobenzene SMILES: C1=CC(=CC=C1N=C=O)I
| PubChem CID | 3399787 |
|---|---|
| CAS | 15845-62-2 |
| Molecular Weight (g/mol) | 245.019 |
| MDL Number | MFCD00013875 |
| SMILES | C1=CC(=CC=C1N=C=O)I |
| Synonym | 4-iodophenyl isocyanate,4-iodophenylisocyanate,1-iodo-4-isocyanato-benzene,p-iodophenylisocyanate,acmc-1bsbj,benzene,1-iodo-4-isocyanato |
| IUPAC Name | 1-iodo-4-isocyanatobenzene |
| InChI Key | KVMKUTIUJGYHBA-UHFFFAOYSA-N |
| Molecular Formula | C7H4INO |
(4-Carboxybutyl)triphenylphosphonium bromide, 98%
CAS: 17814-85-6 Molecular Formula: C23H24BrO2P Molecular Weight (g/mol): 443.32 MDL Number: MFCD00011906 InChI Key: MLOSJPZSZWUDSK-UHFFFAOYSA-N Synonym: 4-carboxybutyl triphenylphosphonium bromide,phosphonium, 4-carboxybutyl triphenyl-, bromide,4-carboxybutyl triphenylphosphanium bromide,carboxybutyltriphenylphosphonium bromide,5-triphenylphosphonio pentanoic acid bromide,4-carboxybutyl-triphenylphosphonium bromide,triphenyl 4-carboxybutyl phosphonium bromide,4-carboxybutyl triphenyl phosphonium bromide PubChem CID: 161236 IUPAC Name: 4-carboxybutyl(triphenyl)phosphanium;bromide SMILES: [Br-].OC(=O)CCCC[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 161236 |
|---|---|
| CAS | 17814-85-6 |
| Molecular Weight (g/mol) | 443.32 |
| MDL Number | MFCD00011906 |
| SMILES | [Br-].OC(=O)CCCC[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 4-carboxybutyl triphenylphosphonium bromide,phosphonium, 4-carboxybutyl triphenyl-, bromide,4-carboxybutyl triphenylphosphanium bromide,carboxybutyltriphenylphosphonium bromide,5-triphenylphosphonio pentanoic acid bromide,4-carboxybutyl-triphenylphosphonium bromide,triphenyl 4-carboxybutyl phosphonium bromide,4-carboxybutyl triphenyl phosphonium bromide |
| IUPAC Name | 4-carboxybutyl(triphenyl)phosphanium;bromide |
| InChI Key | MLOSJPZSZWUDSK-UHFFFAOYSA-N |
| Molecular Formula | C23H24BrO2P |
N-Benzyldimethylamine, 98+%
CAS: 103-83-3 Molecular Formula: C9H13N Molecular Weight (g/mol): 135.21 MDL Number: MFCD00008329 InChI Key: XXBDWLFCJWSEKW-UHFFFAOYSA-N Synonym: n,n-dimethylbenzylamine,benzyldimethylamine,n-benzyldimethylamine,dimethylbenzylamine,bdma,benzenemethanamine, n,n-dimethyl,benzyl-n,n-dimethylamine,n-phenylmethyl dimethylamine,n,n-dimethylbenzenemethanamine,araldite accelerator 062 PubChem CID: 7681 IUPAC Name: N,N-dimethyl-1-phenylmethanamine SMILES: CN(C)CC1=CC=CC=C1
| PubChem CID | 7681 |
|---|---|
| CAS | 103-83-3 |
| Molecular Weight (g/mol) | 135.21 |
| MDL Number | MFCD00008329 |
| SMILES | CN(C)CC1=CC=CC=C1 |
| Synonym | n,n-dimethylbenzylamine,benzyldimethylamine,n-benzyldimethylamine,dimethylbenzylamine,bdma,benzenemethanamine, n,n-dimethyl,benzyl-n,n-dimethylamine,n-phenylmethyl dimethylamine,n,n-dimethylbenzenemethanamine,araldite accelerator 062 |
| IUPAC Name | N,N-dimethyl-1-phenylmethanamine |
| InChI Key | XXBDWLFCJWSEKW-UHFFFAOYSA-N |
| Molecular Formula | C9H13N |
4-Fluorobenzotrifluoride, 98+%
CAS: 402-44-8 Molecular Formula: C7H4F4 Molecular Weight (g/mol): 164.103 MDL Number: MFCD00000399 InChI Key: UNNNAIWPDLRVRN-UHFFFAOYSA-N Synonym: 4-fluorobenzotrifluoride,1-fluoro-4-trifluoromethyl benzene,p-fluorobenzotrifluoride,benzene, 1-fluoro-4-trifluoromethyl,alpha,alpha,alpha,4-tetrafluorotoluene,p-fluorotrifluoromethylbenzene,p-trifluoromethyl fluorobenzene,4-flourobenzotrifluoride,a,a,a,4-tetrafluorotoluene,4-trifluoromethyl fluorobenzene PubChem CID: 67873 IUPAC Name: 1-fluoro-4-(trifluoromethyl)benzene SMILES: C1=CC(=CC=C1C(F)(F)F)F
| PubChem CID | 67873 |
|---|---|
| CAS | 402-44-8 |
| Molecular Weight (g/mol) | 164.103 |
| MDL Number | MFCD00000399 |
| SMILES | C1=CC(=CC=C1C(F)(F)F)F |
| Synonym | 4-fluorobenzotrifluoride,1-fluoro-4-trifluoromethyl benzene,p-fluorobenzotrifluoride,benzene, 1-fluoro-4-trifluoromethyl,alpha,alpha,alpha,4-tetrafluorotoluene,p-fluorotrifluoromethylbenzene,p-trifluoromethyl fluorobenzene,4-flourobenzotrifluoride,a,a,a,4-tetrafluorotoluene,4-trifluoromethyl fluorobenzene |
| IUPAC Name | 1-fluoro-4-(trifluoromethyl)benzene |
| InChI Key | UNNNAIWPDLRVRN-UHFFFAOYSA-N |
| Molecular Formula | C7H4F4 |
o-Toluic acid, 98+%
CAS: 118-90-1 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00002477 InChI Key: ZWLPBLYKEWSWPD-UHFFFAOYSA-N Synonym: o-toluic acid,o-toluylic acid,orthotoluic acid,2-toluic acid,toluic acid,benzoic acid, 2-methyl,o-methylbenzoic acid,2-methyl-benzoic acid,benzoic acid, methyl,o-toluate PubChem CID: 8373 ChEBI: CHEBI:36632 IUPAC Name: 2-methylbenzoic acid SMILES: CC1=CC=CC=C1C(=O)O
| PubChem CID | 8373 |
|---|---|
| CAS | 118-90-1 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:36632 |
| MDL Number | MFCD00002477 |
| SMILES | CC1=CC=CC=C1C(=O)O |
| Synonym | o-toluic acid,o-toluylic acid,orthotoluic acid,2-toluic acid,toluic acid,benzoic acid, 2-methyl,o-methylbenzoic acid,2-methyl-benzoic acid,benzoic acid, methyl,o-toluate |
| IUPAC Name | 2-methylbenzoic acid |
| InChI Key | ZWLPBLYKEWSWPD-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
4-Iodotoluene, 98%
CAS: 624-31-7 Molecular Formula: C7H7I Molecular Weight (g/mol): 218.037 MDL Number: MFCD00001059 InChI Key: UDHAWRUAECEBHC-UHFFFAOYSA-N Synonym: 4-iodotoluene,p-iodotoluene,benzene, 1-iodo-4-methyl,toluene, p-iodo,p-tolyl iodide,p-methyliodobenzene,1-methyl-4-iodobenzene,1-iodo-4-methyl-benzene,unii-g75kcn1am8,iodotoluene 4- PubChem CID: 12207 IUPAC Name: 1-iodo-4-methylbenzene SMILES: CC1=CC=C(C=C1)I
| PubChem CID | 12207 |
|---|---|
| CAS | 624-31-7 |
| Molecular Weight (g/mol) | 218.037 |
| MDL Number | MFCD00001059 |
| SMILES | CC1=CC=C(C=C1)I |
| Synonym | 4-iodotoluene,p-iodotoluene,benzene, 1-iodo-4-methyl,toluene, p-iodo,p-tolyl iodide,p-methyliodobenzene,1-methyl-4-iodobenzene,1-iodo-4-methyl-benzene,unii-g75kcn1am8,iodotoluene 4- |
| IUPAC Name | 1-iodo-4-methylbenzene |
| InChI Key | UDHAWRUAECEBHC-UHFFFAOYSA-N |
| Molecular Formula | C7H7I |
Salicylhydroxamic acid, 99%, Thermo Scientific Chemicals
CAS: 89-73-6 Molecular Formula: C7H7NO3 Molecular Weight (g/mol): 153.14 InChI Key: HBROZNQEVUILML-UHFFFAOYSA-N Synonym: salicylhydroxamic acid,2-hydroxybenzohydroxamic acid,salicylohydroxamic acid,sham,salicylohydroximic acid,benzamide, n,2-dihydroxy,2-hydroxybenzhydroxamic acid,o-hydroxybenzohydroxamic acid,sha,2,n-dihydroxy-benzamide PubChem CID: 66644 ChEBI: CHEBI:45615 IUPAC Name: N,2-dihydroxybenzamide SMILES: C1=CC=C(C(=C1)C(=O)NO)O
| PubChem CID | 66644 |
|---|---|
| CAS | 89-73-6 |
| Molecular Weight (g/mol) | 153.14 |
| ChEBI | CHEBI:45615 |
| SMILES | C1=CC=C(C(=C1)C(=O)NO)O |
| Synonym | salicylhydroxamic acid,2-hydroxybenzohydroxamic acid,salicylohydroxamic acid,sham,salicylohydroximic acid,benzamide, n,2-dihydroxy,2-hydroxybenzhydroxamic acid,o-hydroxybenzohydroxamic acid,sha,2,n-dihydroxy-benzamide |
| IUPAC Name | N,2-dihydroxybenzamide |
| InChI Key | HBROZNQEVUILML-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO3 |
Ethyl 4-aminobenzoate, 98%
CAS: 94-09-7 Molecular Formula: C9H11NO2 Molecular Weight (g/mol): 165.19 MDL Number: MFCD00007892 InChI Key: BLFLLBZGZJTVJG-UHFFFAOYSA-N Synonym: benzocaine,ethyl aminobenzoate,ethyl p-aminobenzoate,americaine,anesthesin,anaesthesin,ethoform,norcaine,orthesin,parathesin PubChem CID: 2337 ChEBI: CHEBI:116735 IUPAC Name: ethyl 4-aminobenzoate SMILES: CCOC(=O)C1=CC=C(N)C=C1
| PubChem CID | 2337 |
|---|---|
| CAS | 94-09-7 |
| Molecular Weight (g/mol) | 165.19 |
| ChEBI | CHEBI:116735 |
| MDL Number | MFCD00007892 |
| SMILES | CCOC(=O)C1=CC=C(N)C=C1 |
| Synonym | benzocaine,ethyl aminobenzoate,ethyl p-aminobenzoate,americaine,anesthesin,anaesthesin,ethoform,norcaine,orthesin,parathesin |
| IUPAC Name | ethyl 4-aminobenzoate |
| InChI Key | BLFLLBZGZJTVJG-UHFFFAOYSA-N |
| Molecular Formula | C9H11NO2 |
Acetanilide, 99%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 103-84-4
| CAS | 103-84-4 |
|---|
Dioctyl Phthalate, 98%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 117-81-7
| CAS | 117-81-7 |
|---|